C25H33N5O — CID 164857170
(Z)-1-[2-methyl-4-(2-pyridin-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine (PubChem CID 164857170) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is (Z)-1-[2-methyl-4-(2-pyridin-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-[2-methyl-4-(2-pyridin-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857170 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | (Z)-1-[2-methyl-4-(2-pyridin-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
| SMILES | Cc1cc(N2CC3(C2)CN(c2ccccn2)C3)ccc1/C(N)=C/NCC1CCCCO1 |
| InChI | InChI=1S/C25H33N5O/c1-19-12-20(8-9-22(19)23(26)14-27-13-21-6-3-5-11-31-21)29-15-25(16-29)17-30(18-25)24-7-2-4-10-28-24/h2,4,7-10,12,14,21,27H,3,5-6,11,13,15-18,26H2,1H3/b23-14- |
| InChIKey | LOROXIOEYZYRDK-UCQKPKSFSA-N |
| XLogP | 3.13 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|