C19H26N2O — CID 164858003
(Z)-1-(4-but-1-ynyl-2-methylphenyl)-N'-(oxan-2-ylmethyl)ethene-1,2-diamine (PubChem CID 164858003) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (Z)-1-(4-but-1-ynyl-2-methylphenyl)-N'-(oxan-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-(4-but-1-ynyl-2-methylphenyl)-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164858003 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (Z)-1-(4-but-1-ynyl-2-methylphenyl)-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
| SMILES | CCC#Cc1ccc(/C(N)=C/NCC2CCCCO2)c(C)c1 |
| InChI | InChI=1S/C19H26N2O/c1-3-4-7-16-9-10-18(15(2)12-16)19(20)14-21-13-17-8-5-6-11-22-17/h9-10,12,14,17,21H,3,5-6,8,11,13,20H2,1-2H3/b19-14- |
| InChIKey | DOCGLMNBHVZVIV-RGEXLXHISA-N |
| XLogP | 3.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|