C19H25N3O — CID 164857963
(Z)-1-[4-(2-cyclopropylethynyl)-2-methylphenyl]-N'-(morpholin-3-ylmethyl)ethene-1,2-diamine (PubChem CID 164857963) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (Z)-1-[4-(2-cyclopropylethynyl)-2-methylphenyl]-N'-(morpholin-3-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-[4-(2-cyclopropylethynyl)-2-methylphenyl]-N'-(morpholin-3-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857963 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (Z)-1-[4-(2-cyclopropylethynyl)-2-methylphenyl]-N'-(morpholin-3-ylmethyl)ethene-1,2-diamine |
| SMILES | Cc1cc(C#CC2CC2)ccc1/C(N)=C/NCC1COCCN1 |
| InChI | InChI=1S/C19H25N3O/c1-14-10-16(5-4-15-2-3-15)6-7-18(14)19(20)12-21-11-17-13-23-9-8-22-17/h6-7,10,12,15,17,21-22H,2-3,8-9,11,13,20H2,1H3/b19-12- |
| InChIKey | XGFCTEGJRCGDOH-UNOMPAQXSA-N |
| XLogP | 1.59 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|