C19H23N3O — CID 164857293
(2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-yl)ethanimine (PubChem CID 164857293) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-yl)ethanimine.
| Compound Name | (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-yl)ethanimine |
|---|---|
| PubChem CID | 164857293 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-yl)ethanimine |
| SMILES | Cc1cc(C#CC2CC2)ccc1C(/C=N/C1CCCOC1)=N/N |
| InChI | InChI=1S/C19H23N3O/c1-14-11-16(7-6-15-4-5-15)8-9-18(14)19(22-20)12-21-17-3-2-10-23-13-17/h8-9,11-12,15,17H,2-5,10,13,20H2,1H3/b21-12+,22-19+ |
| InChIKey | HLXRMFYPPUDYOF-BRBPWCTISA-N |
| XLogP | 2.67 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|