C18H23N5O — CID 164858110
(2E)-2-[6-(2-cyclopropylethynyl)-4-methylpyridazin-3-yl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine (PubChem CID 164858110) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (2E)-2-[6-(2-cyclopropylethynyl)-4-methylpyridazin-3-yl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine.
| Compound Name | (2E)-2-[6-(2-cyclopropylethynyl)-4-methylpyridazin-3-yl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
|---|---|
| PubChem CID | 164858110 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2E)-2-[6-(2-cyclopropylethynyl)-4-methylpyridazin-3-yl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
| SMILES | Cc1cc(C#CC2CC2)nnc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C18H23N5O/c1-13-10-15(8-7-14-5-6-14)22-23-18(13)17(21-19)12-20-11-16-4-2-3-9-24-16/h10,12,14,16H,2-6,9,11,19H2,1H3/b20-12+,21-17+ |
| InChIKey | UMRZPRDMHVLRNX-PPTAUHKUSA-N |
| XLogP | 1.85 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|