C28H37N5O — CID 164857739
(2Z)-2-[4-(7-benzyl-2,7-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine (PubChem CID 164857739) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is (2Z)-2-[4-(7-benzyl-2,7-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine.
| Compound Name | (2Z)-2-[4-(7-benzyl-2,7-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
|---|---|
| PubChem CID | 164857739 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | (2Z)-2-[4-(7-benzyl-2,7-diazaspiro[3.4]octan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
| SMILES | Cc1cc(N2CC3(CCN(Cc4ccccc4)C3)C2)ccc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C28H37N5O/c1-22-15-24(10-11-26(22)27(31-29)17-30-16-25-9-5-6-14-34-25)33-20-28(21-33)12-13-32(19-28)18-23-7-3-2-4-8-23/h2-4,7-8,10-11,15,17,25H,5-6,9,12-14,16,18-21,29H2,1H3/b30-17+,31-27+ |
| InChIKey | QKEMCIUKGMELSC-XAYYRUAESA-N |
| XLogP | 4.01 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|