C26H40N6O — CID 164858260
(Z)-N-ethyl-1-[4-[4-methyl-3-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperazin-1-yl]pent-3-en-2-imine (PubChem CID 164858260) has the molecular formula C26H40N6O and a molecular weight of 452.65 g/mol. Its IUPAC name is (Z)-N-ethyl-1-[4-[4-methyl-3-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperazin-1-yl]pent-3-en-2-imine.
| Compound Name | (Z)-N-ethyl-1-[4-[4-methyl-3-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperazin-1-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 164858260 |
| Molecular Formula | C26H40N6O |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (Z)-N-ethyl-1-[4-[4-methyl-3-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperazin-1-yl]pent-3-en-2-imine |
| SMILES | C/C=C\C(CN1CCN(c2ccc(C)c(C(/C=N/CC3CCCCO3)=N/N)c2)CC1)=N/CC |
| InChI | InChI=1S/C26H40N6O/c1-4-8-22(29-5-2)20-31-12-14-32(15-13-31)23-11-10-21(3)25(17-23)26(30-27)19-28-18-24-9-6-7-16-33-24/h4,8,10-11,17,19,24H,5-7,9,12-16,18,20,27H2,1-3H3/b8-4-,28-19+,29-22+,30-26+ |
| InChIKey | SYIZBJPESJARDS-QUQKYNDDSA-N |
| XLogP | 3.46 |
| TPSA | 78.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|