C27H35N5O — CID 164856837
(2Z)-2-[4-(6-benzyl-2,6-diazaspiro[3.3]heptan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine (PubChem CID 164856837) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is (2Z)-2-[4-(6-benzyl-2,6-diazaspiro[3.3]heptan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine.
| Compound Name | (2Z)-2-[4-(6-benzyl-2,6-diazaspiro[3.3]heptan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
|---|---|
| PubChem CID | 164856837 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (2Z)-2-[4-(6-benzyl-2,6-diazaspiro[3.3]heptan-2-yl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
| SMILES | Cc1cc(N2CC3(CN(Cc4ccccc4)C3)C2)ccc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C27H35N5O/c1-21-13-23(10-11-25(21)26(30-28)15-29-14-24-9-5-6-12-33-24)32-19-27(20-32)17-31(18-27)16-22-7-3-2-4-8-22/h2-4,7-8,10-11,13,15,24H,5-6,9,12,14,16-20,28H2,1H3/b29-15+,30-26+ |
| InChIKey | AUSNAIPIRXBXBJ-TZGCCVIQSA-N |
| XLogP | 3.62 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|