C20H31N5O — CID 164857824
[3-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]azetidin-3-yl]methanamine (PubChem CID 164857824) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is [3-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]azetidin-3-yl]methanamine.
| Compound Name | [3-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]azetidin-3-yl]methanamine |
|---|---|
| PubChem CID | 164857824 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | [3-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]azetidin-3-yl]methanamine |
| SMILES | Cc1cc(N2CC(C)(CN)C2)ccc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C20H31N5O/c1-15-9-16(25-13-20(2,12-21)14-25)6-7-18(15)19(24-22)11-23-10-17-5-3-4-8-26-17/h6-7,9,11,17H,3-5,8,10,12-14,21-22H2,1-2H3/b23-11+,24-19+ |
| InChIKey | PGYHVPINBIOIEW-DPUQVZPMSA-N |
| XLogP | 2.08 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|