C23H37N5O — CID 164857580
3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]-N-(3-piperidin-1-ylpropyl)aniline (PubChem CID 164857580) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is 3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]-N-(3-piperidin-1-ylpropyl)aniline.
| Compound Name | 3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]-N-(3-piperidin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 164857580 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]-N-(3-piperidin-1-ylpropyl)aniline |
| SMILES | Cc1cc(NCCCN2CCCCC2)ccc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C23H37N5O/c1-19-16-20(26-11-7-14-28-12-4-2-5-13-28)9-10-22(19)23(27-24)18-25-17-21-8-3-6-15-29-21/h9-10,16,18,21,26H,2-8,11-15,17,24H2,1H3/b25-18+,27-23+ |
| InChIKey | CBEZQSAIBDSWJF-KNUHODRNSA-N |
| XLogP | 3.59 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|