C21H32N4O — CID 164857513
(2Z)-2-[4-(3,3-dimethylazetidin-1-yl)-2-ethylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine (PubChem CID 164857513) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (2Z)-2-[4-(3,3-dimethylazetidin-1-yl)-2-ethylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine.
| Compound Name | (2Z)-2-[4-(3,3-dimethylazetidin-1-yl)-2-ethylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
|---|---|
| PubChem CID | 164857513 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (2Z)-2-[4-(3,3-dimethylazetidin-1-yl)-2-ethylphenyl]-2-hydrazinylidene-N-(oxan-2-ylmethyl)ethanimine |
| SMILES | CCc1cc(N2CC(C)(C)C2)ccc1C(/C=N/CC1CCCCO1)=N/N |
| InChI | InChI=1S/C21H32N4O/c1-4-16-11-17(25-14-21(2,3)15-25)8-9-19(16)20(24-22)13-23-12-18-7-5-6-10-26-18/h8-9,11,13,18H,4-7,10,12,14-15,22H2,1-3H3/b23-13+,24-20+ |
| InChIKey | RFINEGBKRYPUFK-WGHMEBRLSA-N |
| XLogP | 3.40 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|