C28H41N5O — CID 164857701
N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperidin-3-amine (PubChem CID 164857701) has the molecular formula C28H41N5O and a molecular weight of 463.67 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperidin-3-amine.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 164857701 |
| Molecular Formula | C28H41N5O |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-methyl-1-[3-methyl-4-[2-(oxan-2-ylmethylimino)ethanehydrazonoyl]phenyl]piperidin-3-amine |
| SMILES | C=C/C=C(\C=C)CN(C)C1CCCN(c2ccc(C(/C=N/CC3CCCCO3)=N/N)c(C)c2)C1 |
| InChI | InChI=1S/C28H41N5O/c1-5-10-23(6-2)20-32(4)25-11-9-15-33(21-25)24-13-14-27(22(3)17-24)28(31-29)19-30-18-26-12-7-8-16-34-26/h5-6,10,13-14,17,19,25-26H,1-2,7-9,11-12,15-16,18,20-21,29H2,3-4H3/b23-10+,30-19+,31-28+ |
| InChIKey | DSCXOPBRGVUCBH-LRNRKNFJSA-N |
| XLogP | 4.50 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|