C20H25N3O — CID 164857841
(2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-ylmethyl)ethanimine (PubChem CID 164857841) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-ylmethyl)ethanimine.
| Compound Name | (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-ylmethyl)ethanimine |
|---|---|
| PubChem CID | 164857841 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2Z)-2-[4-(2-cyclopropylethynyl)-2-methylphenyl]-2-hydrazinylidene-N-(oxan-3-ylmethyl)ethanimine |
| SMILES | Cc1cc(C#CC2CC2)ccc1C(/C=N/CC1CCCOC1)=N/N |
| InChI | InChI=1S/C20H25N3O/c1-15-11-17(7-6-16-4-5-16)8-9-19(15)20(23-21)13-22-12-18-3-2-10-24-14-18/h8-9,11,13,16,18H,2-5,10,12,14,21H2,1H3/b22-13+,23-20+ |
| InChIKey | DSSXRQKVFPYHAQ-GBXVRFTQSA-N |
| XLogP | 2.92 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|