C21H26N4O — CID 164857933
N-[3-[4-[2-(2-methoxyethylimino)ethanehydrazonoyl]-3-methylphenyl]prop-2-ynyl]aniline;molecular hydrogen (PubChem CID 164857933) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[3-[4-[2-(2-methoxyethylimino)ethanehydrazonoyl]-3-methylphenyl]prop-2-ynyl]aniline;molecular hydrogen.
| Compound Name | N-[3-[4-[2-(2-methoxyethylimino)ethanehydrazonoyl]-3-methylphenyl]prop-2-ynyl]aniline;molecular hydrogen |
|---|---|
| PubChem CID | 164857933 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[3-[4-[2-(2-methoxyethylimino)ethanehydrazonoyl]-3-methylphenyl]prop-2-ynyl]aniline;molecular hydrogen |
| SMILES | COCC/N=C/C(=N\N)c1ccc(C#CCNc2ccccc2)cc1C.[H][H] |
| InChI | InChI=1S/C21H24N4O.H2/c1-17-15-18(7-6-12-24-19-8-4-3-5-9-19)10-11-20(17)21(25-22)16-23-13-14-26-2;/h3-5,8-11,15-16,24H,12-14,22H2,1-2H3;1H/b23-16+,25-21+; |
| InChIKey | GJDAPWWBWNWWQI-DPFJVXDASA-N |
| XLogP | 3.08 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|