C20H25N2O3+ — CID 164858501
[4-(2-cyclopropylethynyl)-2-methylbenzenecarboximidoyl]oxycarbonyl-(oxan-2-ylmethyl)azanium (PubChem CID 164858501) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is [4-(2-cyclopropylethynyl)-2-methylbenzenecarboximidoyl]oxycarbonyl-(oxan-2-ylmethyl)azanium.
| Compound Name | [4-(2-cyclopropylethynyl)-2-methylbenzenecarboximidoyl]oxycarbonyl-(oxan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 164858501 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [4-(2-cyclopropylethynyl)-2-methylbenzenecarboximidoyl]oxycarbonyl-(oxan-2-ylmethyl)azanium |
| SMILES | [H]/N=C(\OC(=O)[NH2+]CC1CCCCO1)c1ccc(C#CC2CC2)cc1C |
| InChI | InChI=1S/C20H24N2O3/c1-14-12-16(8-7-15-5-6-15)9-10-18(14)19(21)25-20(23)22-13-17-4-2-3-11-24-17/h9-10,12,15,17,21H,2-6,11,13H2,1H3,(H,22,23)/p+1/b21-19- |
| InChIKey | OEIVEOJDTXSOLE-VZCXRCSSSA-O |
| XLogP | 2.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|