C13H19NOS — CID 117034338
3-[(3,4-dimethylphenyl)sulfanylmethyl]morpholine (PubChem CID 117034338) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfanylmethyl]morpholine.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 117034338 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfanylmethyl]morpholine |
| SMILES | Cc1ccc(SCC2COCCN2)cc1C |
| InChI | InChI=1S/C13H19NOS/c1-10-3-4-13(7-11(10)2)16-9-12-8-15-6-5-14-12/h3-4,7,12,14H,5-6,8-9H2,1-2H3 |
| InChIKey | NIMOZSMYQLRBTL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |