C23H33N5O2 — CID 164857749
(Z)-1-[2-methyl-4-[4-(1,3-oxazol-2-ylmethyl)piperazin-1-yl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine (PubChem CID 164857749) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (Z)-1-[2-methyl-4-[4-(1,3-oxazol-2-ylmethyl)piperazin-1-yl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-[2-methyl-4-[4-(1,3-oxazol-2-ylmethyl)piperazin-1-yl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857749 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | (Z)-1-[2-methyl-4-[4-(1,3-oxazol-2-ylmethyl)piperazin-1-yl]phenyl]-N'-(oxan-2-ylmethyl)ethene-1,2-diamine |
| SMILES | Cc1cc(N2CCN(Cc3ncco3)CC2)ccc1/C(N)=C/NCC1CCCCO1 |
| InChI | InChI=1S/C23H33N5O2/c1-18-14-19(28-10-8-27(9-11-28)17-23-26-7-13-30-23)5-6-21(18)22(24)16-25-15-20-4-2-3-12-29-20/h5-7,13-14,16,20,25H,2-4,8-12,15,17,24H2,1H3/b22-16- |
| InChIKey | ZPEPKOAUCHMSRI-JWGURIENSA-N |
| XLogP | 2.72 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|