C16H19BrN2O3 — CID 43001037
5-(3-bromophenyl)-5-methyl-3-(oxan-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 43001037) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 5-(3-bromophenyl)-5-methyl-3-(oxan-2-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(3-bromophenyl)-5-methyl-3-(oxan-2-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43001037 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-(3-bromophenyl)-5-methyl-3-(oxan-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc(Br)c2)NC(=O)N(CC2CCCCO2)C1=O |
| InChI | InChI=1S/C16H19BrN2O3/c1-16(11-5-4-6-12(17)9-11)14(20)19(15(21)18-16)10-13-7-2-3-8-22-13/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,18,21) |
| InChIKey | AJEKWWUTECKIPE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|