C16H18N2O5 — CID 8601366
(5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[(2R)-oxolan-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 8601366) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[(2R)-oxolan-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[(2R)-oxolan-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8601366 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[(2R)-oxolan-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc3c(c2)OCO3)NC(=O)N(C[C@H]2CCCO2)C1=O |
| InChI | InChI=1S/C16H18N2O5/c1-16(10-4-5-12-13(7-10)23-9-22-12)14(19)18(15(20)17-16)8-11-3-2-6-21-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,17,20)/t11-,16+/m1/s1 |
| InChIKey | VBOLZQCNWNEDNJ-BZNIZROVSA-N |
| XLogP | 1.36 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|