C20H25N7O3 — CID 170763144
(2Z)-1-[5-cyclopropyloxy-6-[1-(5,7-dioxaspiro[2.5]octan-6-ylmethyl)triazol-4-yl]-3-pyridinyl]-2-hydrazinylidene-N-methylethanimine (PubChem CID 170763144) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is (2Z)-1-[5-cyclopropyloxy-6-[1-(5,7-dioxaspiro[2.5]octan-6-ylmethyl)triazol-4-yl]-3-pyridinyl]-2-hydrazinylidene-N-methylethanimine.
| Compound Name | (2Z)-1-[5-cyclopropyloxy-6-[1-(5,7-dioxaspiro[2.5]octan-6-ylmethyl)triazol-4-yl]-3-pyridinyl]-2-hydrazinylidene-N-methylethanimine |
|---|---|
| PubChem CID | 170763144 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2Z)-1-[5-cyclopropyloxy-6-[1-(5,7-dioxaspiro[2.5]octan-6-ylmethyl)triazol-4-yl]-3-pyridinyl]-2-hydrazinylidene-N-methylethanimine |
| SMILES | C/N=C(/C=N\N)c1cnc(-c2cn(CC3OCC4(CC4)CO3)nn2)c(OC2CC2)c1 |
| InChI | InChI=1S/C20H25N7O3/c1-22-15(8-24-21)13-6-17(30-14-2-3-14)19(23-7-13)16-9-27(26-25-16)10-18-28-11-20(4-5-20)12-29-18/h6-9,14,18H,2-5,10-12,21H2,1H3/b22-15-,24-8- |
| InChIKey | FIGXSQWGLIWYFE-WDGVAOPISA-N |
| XLogP | 1.40 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|