C26H25N3O2 — CID 170763366
acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-5,6-dimethyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one (PubChem CID 170763366) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-5,6-dimethyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one.
| Compound Name | acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-5,6-dimethyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one |
|---|---|
| PubChem CID | 170763366 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-5,6-dimethyl-4-(pyrimidin-2-ylmethoxy)pyridin-2-one |
| SMILES | C#C.Cc1c(OCc2ncccn2)cc(=O)n(Cc2ccc(C#CC3CC3)cc2)c1C |
| InChI | InChI=1S/C24H23N3O2.C2H2/c1-17-18(2)27(15-21-10-8-20(9-11-21)7-6-19-4-5-19)24(28)14-22(17)29-16-23-25-12-3-13-26-23;1-2/h3,8-14,19H,4-5,15-16H2,1-2H3;1-2H |
| InChIKey | SCNRWHHOSXWBQN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|