C22H27N3O2 — CID 170763779
(4R)-N,N-diethyl-11-formyl-6-methyl-6,11-diazatetracyclo[7.6.2.02,7.012,16]heptadeca-1(16),2,9,12,14-pentaene-4-carboxamide (PubChem CID 170763779) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (4R)-N,N-diethyl-11-formyl-6-methyl-6,11-diazatetracyclo[7.6.2.02,7.012,16]heptadeca-1(16),2,9,12,14-pentaene-4-carboxamide.
| Compound Name | (4R)-N,N-diethyl-11-formyl-6-methyl-6,11-diazatetracyclo[7.6.2.02,7.012,16]heptadeca-1(16),2,9,12,14-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 170763779 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (4R)-N,N-diethyl-11-formyl-6-methyl-6,11-diazatetracyclo[7.6.2.02,7.012,16]heptadeca-1(16),2,9,12,14-pentaene-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c3CC(=CN4C=O)CC2N(C)C1 |
| InChI | InChI=1S/C22H27N3O2/c1-4-24(5-2)22(27)16-11-19-17-7-6-8-20-18(17)9-15(12-25(20)14-26)10-21(19)23(3)13-16/h6-8,11-12,14,16,21H,4-5,9-10,13H2,1-3H3/t16-,21?/m1/s1 |
| InChIKey | KUUXPJCCIKJDKG-UJONTBEJSA-N |
| XLogP | 2.68 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|