About methane;1-methyl-3-methylidenecyclohexene;toluene
methane;1-methyl-3-methylidenecyclohexene;toluene (PubChem CID 170763882) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is methane;1-methyl-3-methylidenecyclohexene;toluene.
Molecular Properties
| Compound Name | methane;1-methyl-3-methylidenecyclohexene;toluene |
| PubChem CID | 170763882 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | methane;1-methyl-3-methylidenecyclohexene;toluene |
| SMILES | C.C=C1C=C(C)CCC1.Cc1ccccc1 |
| InChI | InChI=1S/C8H12.C7H8.CH4/c1-7-4-3-5-8(2)6-7;1-7-5-3-2-4-6-7;/h6H,1,3-5H2,2H3;2-6H,1H3;1H4 |
| InChIKey | WHQWASDEWDJTAN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;1-methyl-3-methylidenecyclohexene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-3-methylidenecyclohexene;toluene?
The IUPAC name of methane;1-methyl-3-methylidenecyclohexene;toluene (CID 170763882) is methane;1-methyl-3-methylidenecyclohexene;toluene.
What is the SMILES notation for methane;1-methyl-3-methylidenecyclohexene;toluene?
The canonical SMILES for methane;1-methyl-3-methylidenecyclohexene;toluene is C.C=C1C=C(C)CCC1.Cc1ccccc1.
What is the InChIKey of methane;1-methyl-3-methylidenecyclohexene;toluene?
The InChIKey is WHQWASDEWDJTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.C7H8.CH4/c1-7-4-3-5-8(2)6-7;1-7-5-3-2-4-6-7;/h6H,1,3-5H2,2H3;2-6H,1H3;1H4.
What are the key properties of methane;1-methyl-3-methylidenecyclohexene;toluene?
methane;1-methyl-3-methylidenecyclohexene;toluene has a molecular weight of 216.37 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-3-methylidenecyclohexene;toluene is sourced from PubChem (CID 170763882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).