C30H24N2O2 — CID 170766386
3-[(E)-2-cyanoethenyl]-N-[(4-methylphenyl)methyl]-5-(4-phenoxyphenyl)benzamide (PubChem CID 170766386) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-[(E)-2-cyanoethenyl]-N-[(4-methylphenyl)methyl]-5-(4-phenoxyphenyl)benzamide.
| Compound Name | 3-[(E)-2-cyanoethenyl]-N-[(4-methylphenyl)methyl]-5-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 170766386 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[(E)-2-cyanoethenyl]-N-[(4-methylphenyl)methyl]-5-(4-phenoxyphenyl)benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(/C=C/C#N)cc(-c3ccc(Oc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C30H24N2O2/c1-22-9-11-23(12-10-22)21-32-30(33)27-19-24(6-5-17-31)18-26(20-27)25-13-15-29(16-14-25)34-28-7-3-2-4-8-28/h2-16,18-20H,21H2,1H3,(H,32,33)/b6-5+ |
| InChIKey | OWAWSYFTNBMFOX-AATRIKPKSA-N |
| XLogP | 6.92 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|