About 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole
7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole (PubChem CID 170767517) has the molecular formula C8H8FNS
and a molecular weight of 169.22 g/mol. Its IUPAC name is 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole.
Analyze 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole?
The IUPAC name of 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole (CID 170767517) is 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole.
What is the SMILES notation for 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole?
The canonical SMILES for 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole is CC1C=CC(F)=C2SC=NC21.
What is the InChIKey of 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole?
The InChIKey is AVFHJVKCEAGVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNS/c1-5-2-3-6(9)8-7(5)10-4-11-8/h2-5,7H,1H3.
What are the key properties of 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole?
7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole has a molecular weight of 169.22 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methyl-3a,4-dihydro-1,3-benzothiazole is sourced from PubChem (CID 170767517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).