C9H15F2N — CID 170768263
1-(4,4-difluorobut-1-en-2-yl)-3-methylpyrrolidine (PubChem CID 170768263) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-(4,4-difluorobut-1-en-2-yl)-3-methylpyrrolidine.
| Compound Name | 1-(4,4-difluorobut-1-en-2-yl)-3-methylpyrrolidine |
|---|---|
| PubChem CID | 170768263 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-(4,4-difluorobut-1-en-2-yl)-3-methylpyrrolidine |
| SMILES | C=C(CC(F)F)N1CCC(C)C1 |
| InChI | InChI=1S/C9H15F2N/c1-7-3-4-12(6-7)8(2)5-9(10)11/h7,9H,2-6H2,1H3 |
| InChIKey | HQBFBLMTFJLYNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |