C12H18F3NO5S2 — CID 170770087
(2S)-2-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(1,2-thiazol-3-yl)butyl]sulfonylbutane-1,1-diol (PubChem CID 170770087) has the molecular formula C12H18F3NO5S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is (2S)-2-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(1,2-thiazol-3-yl)butyl]sulfonylbutane-1,1-diol.
| Compound Name | (2S)-2-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(1,2-thiazol-3-yl)butyl]sulfonylbutane-1,1-diol |
|---|---|
| PubChem CID | 170770087 |
| Molecular Formula | C12H18F3NO5S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (2S)-2-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(1,2-thiazol-3-yl)butyl]sulfonylbutane-1,1-diol |
| SMILES | C[C@@H](CCS(=O)(=O)CCC(O)(c1ccsn1)C(F)(F)F)C(O)O |
| InChI | InChI=1S/C12H18F3NO5S2/c1-8(10(17)18)3-6-23(20,21)7-4-11(19,12(13,14)15)9-2-5-22-16-9/h2,5,8,10,17-19H,3-4,6-7H2,1H3/t8-,11?/m0/s1 |
| InChIKey | WMIUYLALHSLLRU-YMNIQAILSA-N |
| XLogP | 1.03 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|