C8H11NO3S2 — CID 130646686
2-methyl-1,1-dioxo-3-(1,2-thiazol-3-yl)thiolan-3-ol (PubChem CID 130646686) has the molecular formula C8H11NO3S2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methyl-1,1-dioxo-3-(1,2-thiazol-3-yl)thiolan-3-ol.
| Compound Name | 2-methyl-1,1-dioxo-3-(1,2-thiazol-3-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 130646686 |
| Molecular Formula | C8H11NO3S2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 2-methyl-1,1-dioxo-3-(1,2-thiazol-3-yl)thiolan-3-ol |
| SMILES | CC1C(O)(c2ccsn2)CCS1(=O)=O |
| InChI | InChI=1S/C8H11NO3S2/c1-6-8(10,3-5-14(6,11)12)7-2-4-13-9-7/h2,4,6,10H,3,5H2,1H3 |
| InChIKey | GKFMDTRQSCHYNX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |