C8H11NOS2 — CID 130694348
1,2-thiazol-3-yl(thiolan-3-yl)methanol (PubChem CID 130694348) has the molecular formula C8H11NOS2 and a molecular weight of 201.32 g/mol. Its IUPAC name is 1,2-thiazol-3-yl(thiolan-3-yl)methanol.
| Compound Name | 1,2-thiazol-3-yl(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 130694348 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 1,2-thiazol-3-yl(thiolan-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CCSC1 |
| InChI | InChI=1S/C8H11NOS2/c10-8(6-1-3-11-5-6)7-2-4-12-9-7/h2,4,6,8,10H,1,3,5H2 |
| InChIKey | IODASTRGTRWLSS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |