C9H13NOS2 — CID 126985730
thian-2-yl(1,2-thiazol-3-yl)methanol (PubChem CID 126985730) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is thian-2-yl(1,2-thiazol-3-yl)methanol.
| Compound Name | thian-2-yl(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 126985730 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | thian-2-yl(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CCCCS1 |
| InChI | InChI=1S/C9H13NOS2/c11-9(7-4-6-13-10-7)8-3-1-2-5-12-8/h4,6,8-9,11H,1-3,5H2 |
| InChIKey | PBZVRNDDMVWOHA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |