C9H15F3N4S — CID 170770639
1-(1H-1,2,4-triazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine (PubChem CID 170770639) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 170770639 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine |
| SMILES | NC(CCSCCCC(F)(F)F)c1ncn[nH]1 |
| InChI | InChI=1S/C9H15F3N4S/c10-9(11,12)3-1-4-17-5-2-7(13)8-14-6-15-16-8/h6-7H,1-5,13H2,(H,14,15,16) |
| InChIKey | FGBVFVZOXRKFHV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|