C11H23NO — CID 170771620
methane;[(2S)-1-methyl-4-methylidene-2-propylpyrrolidin-2-yl]methanol (PubChem CID 170771620) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is methane;[(2S)-1-methyl-4-methylidene-2-propylpyrrolidin-2-yl]methanol.
| Compound Name | methane;[(2S)-1-methyl-4-methylidene-2-propylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 170771620 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | methane;[(2S)-1-methyl-4-methylidene-2-propylpyrrolidin-2-yl]methanol |
| SMILES | C.C=C1CN(C)[C@@](CO)(CCC)C1 |
| InChI | InChI=1S/C10H19NO.CH4/c1-4-5-10(8-12)6-9(2)7-11(10)3;/h12H,2,4-8H2,1,3H3;1H4/t10-;/m0./s1 |
| InChIKey | VGCVVNHHUGZUPA-PPHPATTJSA-N |
| XLogP | 2.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|