C11H19F2NO — CID 164922426
[(4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-propylpyrrolidin-2-yl]methanol (PubChem CID 164922426) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is [(4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-propylpyrrolidin-2-yl]methanol.
| Compound Name | [(4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-propylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 164922426 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | [(4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-propylpyrrolidin-2-yl]methanol |
| SMILES | CCCC1(CO)C/C(=C/C(F)F)CN1C |
| InChI | InChI=1S/C11H19F2NO/c1-3-4-11(8-15)6-9(5-10(12)13)7-14(11)2/h5,10,15H,3-4,6-8H2,1-2H3/b9-5- |
| InChIKey | SFBGAINXBZOEAH-UITAMQMPSA-N |
| XLogP | 2.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|