C13H23F2NO — CID 164922134
(4Z)-4-(2,2-difluoroethylidene)-2-(ethoxymethyl)-1-methyl-2-propylpyrrolidine (PubChem CID 164922134) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is (4Z)-4-(2,2-difluoroethylidene)-2-(ethoxymethyl)-1-methyl-2-propylpyrrolidine.
| Compound Name | (4Z)-4-(2,2-difluoroethylidene)-2-(ethoxymethyl)-1-methyl-2-propylpyrrolidine |
|---|---|
| PubChem CID | 164922134 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (4Z)-4-(2,2-difluoroethylidene)-2-(ethoxymethyl)-1-methyl-2-propylpyrrolidine |
| SMILES | CCCC1(COCC)C/C(=C/C(F)F)CN1C |
| InChI | InChI=1S/C13H23F2NO/c1-4-6-13(10-17-5-2)8-11(7-12(14)15)9-16(13)3/h7,12H,4-6,8-10H2,1-3H3/b11-7- |
| InChIKey | FGGYMDBTVWQKTB-XFFZJAGNSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|