C13H21F2NO — CID 164922238
(6Z)-6-(2,2-difluoroethylidene)-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 164922238) has the molecular formula C13H21F2NO and a molecular weight of 245.31 g/mol. Its IUPAC name is (6Z)-6-(2,2-difluoroethylidene)-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | (6Z)-6-(2,2-difluoroethylidene)-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 164922238 |
| Molecular Formula | C13H21F2NO |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (6Z)-6-(2,2-difluoroethylidene)-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | CC(C)OCC12CCCN1C/C(=C\C(F)F)C2 |
| InChI | InChI=1S/C13H21F2NO/c1-10(2)17-9-13-4-3-5-16(13)8-11(7-13)6-12(14)15/h6,10,12H,3-5,7-9H2,1-2H3/b11-6- |
| InChIKey | PEGYGCSSCIYTGP-WDZFZDKYSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|