C10H15F2NO — CID 164922515
[(6Z)-6-(2,2-difluoroethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol (PubChem CID 164922515) has the molecular formula C10H15F2NO and a molecular weight of 203.23 g/mol. Its IUPAC name is [(6Z)-6-(2,2-difluoroethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol.
| Compound Name | [(6Z)-6-(2,2-difluoroethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 164922515 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [(6Z)-6-(2,2-difluoroethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
| SMILES | OCC12CCCN1C/C(=C\C(F)F)C2 |
| InChI | InChI=1S/C10H15F2NO/c11-9(12)4-8-5-10(7-14)2-1-3-13(10)6-8/h4,9,14H,1-3,5-7H2/b8-4- |
| InChIKey | KLTOTMXJEKNYDI-YWEYNIOJSA-N |
| XLogP | 1.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|