C14H25F2NO — CID 164922210
(4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-(propan-2-yloxymethyl)-2-propylpyrrolidine (PubChem CID 164922210) has the molecular formula C14H25F2NO and a molecular weight of 261.36 g/mol. Its IUPAC name is (4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-(propan-2-yloxymethyl)-2-propylpyrrolidine.
| Compound Name | (4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-(propan-2-yloxymethyl)-2-propylpyrrolidine |
|---|---|
| PubChem CID | 164922210 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (4Z)-4-(2,2-difluoroethylidene)-1-methyl-2-(propan-2-yloxymethyl)-2-propylpyrrolidine |
| SMILES | CCCC1(COC(C)C)C/C(=C/C(F)F)CN1C |
| InChI | InChI=1S/C14H25F2NO/c1-5-6-14(10-18-11(2)3)8-12(7-13(15)16)9-17(14)4/h7,11,13H,5-6,8-10H2,1-4H3/b12-7- |
| InChIKey | OHPIFHMUYAROJZ-GHXNOFRVSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|