C29H24BNO3S — CID 170776594
2-naphthalen-2-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-f][1,3]benzothiazole (PubChem CID 170776594) has the molecular formula C29H24BNO3S and a molecular weight of 477.39 g/mol. Its IUPAC name is 2-naphthalen-2-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-f][1,3]benzothiazole.
| Compound Name | 2-naphthalen-2-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 170776594 |
| Molecular Formula | C29H24BNO3S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-naphthalen-2-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-f][1,3]benzothiazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)oc2cc4nc(-c5ccc6ccccc6c5)sc4cc23)OC1(C)C |
| InChI | InChI=1S/C29H24BNO3S/c1-28(2)29(3,4)34-30(33-28)20-11-12-21-22-15-26-23(16-25(22)32-24(21)14-20)31-27(35-26)19-10-9-17-7-5-6-8-18(17)13-19/h5-16H,1-4H3 |
| InChIKey | YPVDMTWFASROKJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|