C38H23NO2 — CID 170779671
2,5,6,7,8,12,14,15,17,19,20-undecadeuterio-N-dibenzofuran-2-yl-N-phenyl-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16(21),17,19-decaen-18-amine (PubChem CID 170779671) has the molecular formula C38H23NO2 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2,5,6,7,8,12,14,15,17,19,20-undecadeuterio-N-dibenzofuran-2-yl-N-phenyl-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16(21),17,19-decaen-18-amine.
| Compound Name | 2,5,6,7,8,12,14,15,17,19,20-undecadeuterio-N-dibenzofuran-2-yl-N-phenyl-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16(21),17,19-decaen-18-amine |
|---|---|
| PubChem CID | 170779671 |
| Molecular Formula | C38H23NO2 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 2,5,6,7,8,12,14,15,17,19,20-undecadeuterio-N-dibenzofuran-2-yl-N-phenyl-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16(21),17,19-decaen-18-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c4c([2H])c([2H])c5c([2H])c(N(c6ccccc6)c6ccc7oc8ccccc8c7c6)c([2H])c([2H])c5c4c([2H])c32)c1[2H] |
| InChI | InChI=1S/C38H23NO2/c1-2-8-26(9-3-1)39(28-17-19-37-33(22-28)30-10-4-6-12-35(30)40-37)27-16-18-29-24(20-27)14-15-25-21-38-34(23-32(25)29)31-11-5-7-13-36(31)41-38/h1-23H/i5D,7D,11D,13D,14D,15D,16D,18D,20D,21D,23D |
| InChIKey | KDXWNBDZEZADSX-RWZHUOTESA-N |
| XLogP | 11.26 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|