C46H44N2OPtSSe — CID 170780795
CID 170780795 (PubChem CID 170780795) has the molecular formula C46H44N2OPtSSe and a molecular weight of 946.98 g/mol.
| Compound Name | CID 170780795 |
|---|---|
| PubChem CID | 170780795 |
| Molecular Formula | C46H44N2OPtSSe |
| Molecular Weight | 946.98 g/mol |
| Exact Mass | 947.20 |
| IUPAC Name | — |
| SMILES | Cc1cc([Se]c2cc(C(C)(C)C)cc(-c3[c-]ccc(C(C)(C)C)c3)n2)nc2c1sc1cc(CC(C)(C)C)cc3oc4c5ccccc5[c-]c2c4c31.[Pt+2] |
| InChI | InChI=1S/C46H44N2OSSe.Pt/c1-26-18-37(51-38-24-31(46(8,9)10)23-34(47-38)29-15-13-16-30(21-29)45(5,6)7)48-41-33-22-28-14-11-12-17-32(28)42-39(33)40-35(49-42)19-27(25-44(2,3)4)20-36(40)50-43(26)41;/h11-14,16-21,23-24H,25H2,1-10H3;/q-2;+2 |
| InChIKey | FPYQWVGPDQDYGT-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.98 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|