C20H26N6O4 — CID 170780964
2-[8-[[(Z)-[(Z)-3-aminoprop-2-enylidene]amino]methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 170780964) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[8-[[(Z)-[(Z)-3-aminoprop-2-enylidene]amino]methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[8-[[(Z)-[(Z)-3-aminoprop-2-enylidene]amino]methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 170780964 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[8-[[(Z)-[(Z)-3-aminoprop-2-enylidene]amino]methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)NC2(CCN(C/N=C\C=C/N)CC2)C1=O |
| InChI | InChI=1S/C20H26N6O4/c1-30-16-6-3-2-5-15(16)23-17(27)13-26-18(28)20(24-19(26)29)7-11-25(12-8-20)14-22-10-4-9-21/h2-6,9-10H,7-8,11-14,21H2,1H3,(H,23,27)(H,24,29)/b9-4-,22-10- |
| InChIKey | GECWRJIZFBVSRP-MQMFASJASA-N |
| XLogP | 0.52 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|