C17H14IN3O3 — CID 170785513
[4-(2-iodofuro[3,2-b]pyridin-7-yl)-2-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 170785513) has the molecular formula C17H14IN3O3 and a molecular weight of 435.22 g/mol. Its IUPAC name is [4-(2-iodofuro[3,2-b]pyridin-7-yl)-2-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2-iodofuro[3,2-b]pyridin-7-yl)-2-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 170785513 |
| Molecular Formula | C17H14IN3O3 |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | [4-(2-iodofuro[3,2-b]pyridin-7-yl)-2-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2ccnc3cc(I)oc23)ccn1)N1CCOCC1 |
| InChI | InChI=1S/C17H14IN3O3/c18-15-10-13-16(24-15)12(2-4-19-13)11-1-3-20-14(9-11)17(22)21-5-7-23-8-6-21/h1-4,9-10H,5-8H2 |
| InChIKey | YGHFIDLSANSWPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|