C12H11ClF4N2 — CID 170786682
1-[(3Z,5Z)-5-(chloromethyl)-6-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)pyrazole (PubChem CID 170786682) has the molecular formula C12H11ClF4N2 and a molecular weight of 294.68 g/mol. Its IUPAC name is 1-[(3Z,5Z)-5-(chloromethyl)-6-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(3Z,5Z)-5-(chloromethyl)-6-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 170786682 |
| Molecular Formula | C12H11ClF4N2 |
| Molecular Weight | 294.68 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-[(3Z,5Z)-5-(chloromethyl)-6-fluorohepta-1,3,5-trien-2-yl]-4-(trifluoromethyl)pyrazole |
| SMILES | C=C(/C=C\C(CCl)=C(/C)F)n1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H11ClF4N2/c1-8(3-4-10(5-13)9(2)14)19-7-11(6-18-19)12(15,16)17/h3-4,6-7H,1,5H2,2H3/b4-3-,10-9- |
| InChIKey | XXTVGPWQJSNGCB-RTAKVZRXSA-N |
| XLogP | 4.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|