C15H17FN2 — CID 130228195
4-ethynyl-1-[(2E,4E,6Z)-2-fluoro-7-methylnona-2,4,6-trien-5-yl]pyrazole (PubChem CID 130228195) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 4-ethynyl-1-[(2E,4E,6Z)-2-fluoro-7-methylnona-2,4,6-trien-5-yl]pyrazole.
| Compound Name | 4-ethynyl-1-[(2E,4E,6Z)-2-fluoro-7-methylnona-2,4,6-trien-5-yl]pyrazole |
|---|---|
| PubChem CID | 130228195 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-ethynyl-1-[(2E,4E,6Z)-2-fluoro-7-methylnona-2,4,6-trien-5-yl]pyrazole |
| SMILES | C#Cc1cnn(C(/C=C(/C)CC)=C/C=C(\C)F)c1 |
| InChI | InChI=1S/C15H17FN2/c1-5-12(3)9-15(8-7-13(4)16)18-11-14(6-2)10-17-18/h2,7-11H,5H2,1,3-4H3/b12-9-,13-7+,15-8+ |
| InChIKey | HXYPBEYWOFVPBX-NSKLZTASSA-N |
| XLogP | 3.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|