C30H50 — CID 170790563
10,13-dimethyl-17-[(E)-6-methyl-5-propan-2-ylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 170790563) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is 10,13-dimethyl-17-[(E)-6-methyl-5-propan-2-ylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 10,13-dimethyl-17-[(E)-6-methyl-5-propan-2-ylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 170790563 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 10,13-dimethyl-17-[(E)-6-methyl-5-propan-2-ylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)C(/C=C/C(C)C1CCC2C3CC=C4CCCCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C30H50/c1-20(2)24(21(3)4)13-11-22(5)26-15-16-27-25-14-12-23-10-8-9-18-29(23,6)28(25)17-19-30(26,27)7/h11-13,20-22,24-28H,8-10,14-19H2,1-7H3/b13-11+ |
| InChIKey | XUPLNCPQILOXBJ-ACCUITESSA-N |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|