C25H38OS — CID 69314351
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(1-prop-2-enylsulfinylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 69314351) has the molecular formula C25H38OS and a molecular weight of 386.65 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(1-prop-2-enylsulfinylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(1-prop-2-enylsulfinylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 69314351 |
| Molecular Formula | C25H38OS |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(1-prop-2-enylsulfinylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=CCS(=O)C(C=C)[C@H]1CC[C@H]2[C@@H]3CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38OS/c1-5-17-27(26)23(6-2)22-13-12-20-19-11-10-18-9-7-8-15-24(18,3)21(19)14-16-25(20,22)4/h5-6,10,19-23H,1-2,7-9,11-17H2,3-4H3/t19-,20-,21-,22+,23?,24-,25-,27?/m0/s1 |
| InChIKey | KJLXLAVGJKKQQJ-PIKNGNMRSA-N |
| XLogP | 6.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|