C19H15NO2 — CID 17079240
7-(furan-2-yl)-4-phenyl-7,8-dihydro-6H-quinolin-5-one (PubChem CID 17079240) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 7-(furan-2-yl)-4-phenyl-7,8-dihydro-6H-quinolin-5-one.
| Compound Name | 7-(furan-2-yl)-4-phenyl-7,8-dihydro-6H-quinolin-5-one |
|---|---|
| PubChem CID | 17079240 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 7-(furan-2-yl)-4-phenyl-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1CC(c2ccco2)Cc2nccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C19H15NO2/c21-17-12-14(18-7-4-10-22-18)11-16-19(17)15(8-9-20-16)13-5-2-1-3-6-13/h1-10,14H,11-12H2 |
| InChIKey | VONGQRBEJWNPOF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |