C27H32N2O4 — CID 170792492
1-(1-methylimidazol-2-yl)ethanol;4-[4-[4-(oxan-4-yloxy)phenyl]phenyl]but-3-yn-1-ol (PubChem CID 170792492) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 1-(1-methylimidazol-2-yl)ethanol;4-[4-[4-(oxan-4-yloxy)phenyl]phenyl]but-3-yn-1-ol.
| Compound Name | 1-(1-methylimidazol-2-yl)ethanol;4-[4-[4-(oxan-4-yloxy)phenyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 170792492 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-(1-methylimidazol-2-yl)ethanol;4-[4-[4-(oxan-4-yloxy)phenyl]phenyl]but-3-yn-1-ol |
| SMILES | CC(O)c1nccn1C.OCCC#Cc1ccc(-c2ccc(OC3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H22O3.C6H10N2O/c22-14-2-1-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)24-21-12-15-23-16-13-21;1-5(9)6-7-3-4-8(6)2/h4-11,21-22H,2,12-16H2;3-5,9H,1-2H3 |
| InChIKey | ZPCFETUUHVRTQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|