About 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine
3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine (PubChem CID 170793879) has the molecular formula C15H11Cl2N3O2
and a molecular weight of 336.18 g/mol. Its IUPAC name is 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine |
| PubChem CID | 170793879 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine |
| SMILES | COc1ccc(COc2nc3cc(Cl)ncc3nc2Cl)cc1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-21-10-4-2-9(3-5-10)8-22-15-14(17)19-12-7-18-13(16)6-11(12)20-15/h2-7H,8H2,1H3 |
| InChIKey | UMLVIPXEPBWFLA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine?
The IUPAC name of 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine (CID 170793879) is 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine.
What is the SMILES notation for 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine?
The canonical SMILES for 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine is COc1ccc(COc2nc3cc(Cl)ncc3nc2Cl)cc1.
What is the InChIKey of 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine?
The InChIKey is UMLVIPXEPBWFLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O2/c1-21-10-4-2-9(3-5-10)8-22-15-14(17)19-12-7-18-13(16)6-11(12)20-15/h2-7H,8H2,1H3.
What are the key properties of 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine?
3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine has a molecular weight of 336.18 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dichloro-2-[(4-methoxyphenyl)methoxy]pyrido[3,4-b]pyrazine is sourced from PubChem (CID 170793879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).