C14H10Cl2F3NO2 — CID 134106504
2,5-dichloro-6-[(4-methoxyphenyl)methoxy]-3-(trifluoromethyl)pyridine (PubChem CID 134106504) has the molecular formula C14H10Cl2F3NO2 and a molecular weight of 352.14 g/mol. Its IUPAC name is 2,5-dichloro-6-[(4-methoxyphenyl)methoxy]-3-(trifluoromethyl)pyridine.
| Compound Name | 2,5-dichloro-6-[(4-methoxyphenyl)methoxy]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134106504 |
| Molecular Formula | C14H10Cl2F3NO2 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2,5-dichloro-6-[(4-methoxyphenyl)methoxy]-3-(trifluoromethyl)pyridine |
| SMILES | COc1ccc(COc2nc(Cl)c(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2F3NO2/c1-21-9-4-2-8(3-5-9)7-22-13-11(15)6-10(12(16)20-13)14(17,18)19/h2-6H,7H2,1H3 |
| InChIKey | QPIFGTTYEKDCIU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|